EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O5S |
| Net Charge | 0 |
| Average Mass | 264.303 |
| Monoisotopic Mass | 264.07799 |
| SMILES | CC(=O)NC(CSCC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16N2O5S/c1-5(12)11-7(9(15)16)4-17-3-2-6(10)8(13)14/h6-7H,2-4,10H2,1H3,(H,11,12)(H,13,14)(H,15,16)/t6-,7?/m0/s1 |
| InChIKey | QWACVTVBTRSCRL-PKPIPKONSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | Article (MetaGene: http://www.metagene.de/program/d.prg?mp=gamma-CYSTATHIONASE%20DEFICIENCY%20(CTH)) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Acetylcystathionine (CHEBI:88610) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-4-[(2-carboxy-2-acetamidoethyl)sulfanyl]butanoic acid | HMDB |
| Nac-cysta | HMDB |
| N-Monoacetylcystathionine | HMDB |
| S-(2-(Acetylamino)-2-carboxyethyl)-L-Homocysteine | HMDB |
| S-(L-2-(Acetylamino)-2-carboxyethyl)-L-homocysteine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002381 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:20619-80-1 | KEGG COMPOUND |
| Citations |
|---|