EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO3 |
| Net Charge | 0 |
| Average Mass | 207.229 |
| Monoisotopic Mass | 207.08954 |
| SMILES | O=C(O)CNC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C11H13NO3/c13-10(12-8-11(14)15)7-6-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,12,13)(H,14,15) |
| InChIKey | YEIQSAXUPKPPBN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | Article (MetaGene: http://www.metagene.de/program/d.prg?mp=MEDIUM%20CHAIN%20ACYL-COA%20DEHYDROGENASE%20DEFICIENCY%20(MCAD)) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phenylpropionylglycine (CHEBI:88550) is a N-acylglycine (CHEBI:16180) |
| Synonyms | Source |
|---|---|
| (3-phenyl-propionylamino)-acetic acid | HMDB |
| N-(3-Phenylpropanoyl)glycine | HMDB |
| (3-Phenylpropionyl)glycine | HMDB |
| 2-(3-phenylpropanamido)acetic acid | HMDB |
| (3-phenyl-propionylamino)-acetate | HMDB |
| N-(3-Phenyl-propionyl)-glycine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000860 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:56613-60-6 | KEGG COMPOUND |
| Citations |
|---|