EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20O |
| Net Charge | 0 |
| Average Mass | 192.302 |
| Monoisotopic Mass | 192.15142 |
| SMILES | CC(=O)CCC1=C(C)C=CCC1(C)C |
| InChI | InChI=1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h5-6H,7-9H2,1-4H3 |
| InChIKey | SQFRYZPEWOZAKJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrodehydro-β-ionone (CHEBI:88549) has role flavouring agent (CHEBI:35617) |
| dihydrodehydro-β-ionone (CHEBI:88549) has role human urinary metabolite (CHEBI:84087) |
| dihydrodehydro-β-ionone (CHEBI:88549) is a cyclohexadiene (CHEBI:37613) |
| dihydrodehydro-β-ionone (CHEBI:88549) is a methyl ketone (CHEBI:51867) |
| IUPAC Name |
|---|
| 4-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)butan-2-one |
| Synonyms | Source |
|---|---|
| 3,4-didehydro-7,8-dihydro-β-ionone | NIST Chemistry WebBook |
| 4-(2,6,6-trimethyl-1,3-cyclohexadien-1-yl)-2-butanone | HMDB |
| 4-(2,6,6-trimethyl-1,3-cyclohexadien-1-yl)butan-2-one | ChemIDplus |
| 4-(2,6,6-trimethyl-1,3-cyclohexadienyl)-2-butanone | ChEBI |
| 4-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)butan-2-one | HMDB |
| 4-(2,6,6-trimethylcyclohexa-1,3-dienyl)butan-2-one | HMDB |
| Manual Xrefs | Databases |
|---|---|
| FDB016134 | FooDB |
| HMDB0037139 | HMDB |
| US3928645 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2641515 | Reaxys |
| CAS:20483-36-7 | ChemIDplus |
| CAS:20483-36-7 | NIST Chemistry WebBook |
| Citations |
|---|