EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H31NO4 |
| Net Charge | 0 |
| Average Mass | 313.438 |
| Monoisotopic Mass | 313.22531 |
| SMILES | C=CCCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C17H31NO4/c1-5-6-7-8-9-10-11-12-17(21)22-15(13-16(19)20)14-18(2,3)4/h5,15H,1,6-14H2,2-4H3 |
| InChIKey | GOOOCIIXFLVRAG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (24023812) | ||
| blood (UBERON:0000178) | PubMed (21359215) | ||
| urine (BTO:0001419) | MetaboLights (MTBLS280) | From MetaboLights | |
| blood (UBERON:0000178) | MetaboLights (MTBLS280) | From MetaboLights |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-Decenoylcarnitine (CHEBI:88543) is a O-acylcarnitine (CHEBI:17387) |
| 9-Decenoylcarnitine (CHEBI:88543) is a O-decenoylcarnitine (CHEBI:86063) |
| Synonym | Source |
|---|---|
| 3-(dec-9-enoyloxy)-4-(trimethylazaniumyl)butanoate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013205 | HMDB |
| Citations |
|---|