EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O3 |
| Net Charge | 0 |
| Average Mass | 194.230 |
| Monoisotopic Mass | 194.09429 |
| SMILES | CCCCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H14O3/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9/h4-7,12H,2-3,8H2,1H3 |
| InChIKey | QFOHBWFCKVYLES-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | Article (National Health and Nutrition Examination Survey (NHANES Survey) 2013) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Butylparaben (CHEBI:88542) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| 4-(Butoxycarbonyl)phenol | HMDB |
| 4-Hydroxybenzoic acid butyl ester | HMDB |
| 4-Hydroxybenzoic acid, butyl ester | HMDB |
| Aseptoform butyl | HMDB |
| Benzoic acid, 4-hydroxy-, butyl ester | HMDB |
| Benzoic acid, p-hydroxy-, butyl ester | HMDB |
| Manual Xrefs | Databases |
|---|---|
| D01420 | KEGG DRUG |
| HMDB0032575 | HMDB |
| LSM-2161 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:94-26-8 | KEGG COMPOUND |
| CAS:94-26-8 | KEGG COMPOUND |
| Citations |
|---|