EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O5 |
| Net Charge | 0 |
| Average Mass | 212.201 |
| Monoisotopic Mass | 212.06847 |
| SMILES | COc1cc(CC(O)C(=O)O)ccc1O |
| InChI | InChI=1S/C10H12O5/c1-15-9-5-6(2-3-7(9)11)4-8(12)10(13)14/h2-3,5,8,11-12H,4H2,1H3,(H,13,14) |
| InChIKey | SVYIZYRTOYHQRE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (24023812) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vanillactic acid (CHEBI:88526) has functional parent pyruvic acid (CHEBI:32816) |
| Vanillactic acid (CHEBI:88526) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| Synonyms | Source |
|---|---|
| 3-(4-Hydroxy-3-methoxyphenyl)-Lactic acid | HMDB |
| beta-(4-Hydroxy-3-methoxyphenyl)lactic acid | HMDB |
| 3-(4-Hydroxy-3-methoxyphenyl)lactate | HMDB |
| Vanillactate | HMDB |
| 3-(3-Methoxy-4-hydroxyphenyl)lactate | HMDB |
| 3-(4-Hydroxy-3-methoxyphenyl)-Lactate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000913 | HMDB |
| VLA | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:2475-56-1 | KEGG COMPOUND |
| Citations |
|---|