EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O4 |
| Net Charge | 0 |
| Average Mass | 222.240 |
| Monoisotopic Mass | 222.08921 |
| SMILES | CCCCOC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C12H14O4/c1-2-3-8-16-12(15)10-7-5-4-6-9(10)11(13)14/h4-7H,2-3,8H2,1H3,(H,13,14) |
| InChIKey | YZBOVSFWWNVKRJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | Article (National Health and Nutrition Examination Survey (NHANES Survey) 2013) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Monobutylphthalate (CHEBI:88522) has functional parent butan-1-ol (CHEBI:28885) |
| Monobutylphthalate (CHEBI:88522) is a phthalic acid monoester (CHEBI:132610) |
| Synonyms | Source |
|---|---|
| 2-(butoxycarbonyl)benzoic acid | HMDB |
| -N-butyl-phthalate | HMDB |
| 2-(Butoxycarbonyl)benzoate | HMDB |
| Butyl hydrogen phthalate | HMDB |
| Phthalic acid Monobutyl Ester | HMDB |
| Mono-N-butyl phthalate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013247 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:131-70-4 | KEGG COMPOUND |
| Citations |
|---|