EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H74NO10P |
| Net Charge | 0 |
| Average Mass | 784.025 |
| Monoisotopic Mass | 783.50503 |
| SMILES | [H][C@@](COC(=O)CCCCCCC/C=C\C/C=C\CCCCC)(COP(=O)(O)OC[C@]([H])(N)C(=O)O)OC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C42H74NO10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(44)50-35-38(36-51-54(48,49)52-37-39(43)42(46)47)53-41(45)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,38-39H,3-10,15-16,21-37,43H2,1-2H3,(H,46,47)(H,48,49)/b13-11-,14-12-,19-17-,20-18-/t38-,39+/m1/s1 |
| InChIKey | ZTNFQEXYTMNFHG-SOFXVBFTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (20671299) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PS(18:2(9Z,12Z)/18:2(9Z,12Z)) (CHEBI:88488) is a phosphatidylserine 36:4 (CHEBI:136247) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-({[(2R)-2,3-bis[(9Z,12Z)-octadeca-9,12-dienoyloxy]propoxy](hydroxy)phosphoryl}oxy)propanoic acid |
| Synonyms | Source |
|---|---|
| PS(18:2/18:2) | HMDB |
| PSer(18:2/18:2) | HMDB |
| PSer(18:2w6/18:2w6) | HMDB |
| 1,2-Dilinoleoyl-rac-glycero-3-phosphoserine | HMDB |
| Phosphatidylserine(18:2w6/18:2w6) | HMDB |
| PSer(18:2n6/18:2n6) | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0012402 | HMDB |
| LMGP03010023 | LIPID MAPS |
| Citations |
|---|