EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O2 |
| Net Charge | 0 |
| Average Mass | 280.452 |
| Monoisotopic Mass | 280.24023 |
| SMILES | CCCCCC/C=C/C=C/CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10H,2-6,11-17H2,1H3,(H,19,20)/b8-7+,10-9+ |
| InChIKey | JBYXPOFIGCOSSB-XBLVEGMJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO_0000131) | PubMed (2975566) | |
| Lactobacillus acidophilus (ncbitaxon:1579) | - | PubMed (11229917) | Strain: AKU 1137 |
| Lactobacillus plantarum (ncbitaxon:1590) | - | PubMed (12619692) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antiatherogenic agent A cardiovascular drug that prevents atherogenesis, the accumulation of lipid-containing plaques on the innermost layers of the arteries. Compare with antiatherosclerotic agent. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9E,11E)-octadecadienoic acid (CHEBI:88464) has role anti-inflammatory agent (CHEBI:67079) |
| (9E,11E)-octadecadienoic acid (CHEBI:88464) has role antiatherogenic agent (CHEBI:50855) |
| (9E,11E)-octadecadienoic acid (CHEBI:88464) has role antineoplastic agent (CHEBI:35610) |
| (9E,11E)-octadecadienoic acid (CHEBI:88464) has role apoptosis inducer (CHEBI:68495) |
| (9E,11E)-octadecadienoic acid (CHEBI:88464) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| (9E,11E)-octadecadienoic acid (CHEBI:88464) has role human metabolite (CHEBI:77746) |
| (9E,11E)-octadecadienoic acid (CHEBI:88464) is a octadeca-9,11-dienoic acid (CHEBI:36025) |
| (9E,11E)-octadecadienoic acid (CHEBI:88464) is conjugate acid of (9E,11E)-octadecadienoate (CHEBI:194440) |
| Incoming Relation(s) |
| (9Z,11E)-9-hydroperoxyoctadeca-9,11-dienoic acid (CHEBI:144020) has functional parent (9E,11E)-octadecadienoic acid (CHEBI:88464) |
| (9E,11E)-octadecadienoate (CHEBI:194440) is conjugate base of (9E,11E)-octadecadienoic acid (CHEBI:88464) |
| IUPAC Name |
|---|
| (9E,11E)-octadeca-9,11-dienoic acid |
| Synonyms | Source |
|---|---|
| (9E,11E)-9,11-octadecadienoic acid | ChemIDplus |
| 9E,11E-CLA | ChEBI |
| 9E,11E-octadecadienoic acid | ChEBI |
| 9t,11t-CLA | ChEBI |
| 9-trans, 11-trans-CLA | ChEBI |
| 9-trans,11-trans-conjugated linoleic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FDB023609 | FooDB |
| HMDB0005047 | HMDB |
| LMFA01030119 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:544-71-8 | ChemIDplus |
| Citations |
|---|