EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O4 |
| Net Charge | 0 |
| Average Mass | 188.223 |
| Monoisotopic Mass | 188.10486 |
| SMILES | CCCCC[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16O4/c1-2-3-4-5-7(9(12)13)6-8(10)11/h7H,2-6H2,1H3,(H,10,11)(H,12,13)/t7-/m0/s1 |
| InChIKey | FNZSVEHJZREFPF-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (19212411) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nonate (CHEBI:88404) is a dicarboxylic acid (CHEBI:35692) |
| Synonyms | Source |
|---|---|
| 2- Pentylsuccinic acid | HMDB |
| (2R) - 2- pentylbutanedioate | HMDB |
| (2R) - 2- pentylbutanedioic acid | HMDB |
| (2R) - 2- pentylsuccinic acid | HMDB |
| (2S)-2-pentylbutanedioic acid | HMDB |
| Nonic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 2-DH-3-DO-D-ARABINONATE | MetaCyc |
| HMDB0011717 | HMDB |
| Citations |
|---|