EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO5 |
| Net Charge | 0 |
| Average Mass | 253.254 |
| Monoisotopic Mass | 253.09502 |
| SMILES | COc1cc(CC(NC(C)=O)C(=O)O)ccc1O |
| InChI | InChI=1S/C12H15NO5/c1-7(14)13-9(12(16)17)5-8-3-4-10(15)11(6-8)18-2/h3-4,6,9,15H,5H2,1-2H3,(H,13,14)(H,16,17) |
| InChIKey | UKDKTHYZLXZOSS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (16288991) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Acetylvanilalanine (CHEBI:88403) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| 2-acetamido-3-(4-hydroxy-3-methoxyphenyl)propanoic acid | HMDB |
| N-Acetyl-vanilalanine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011716 | HMDB |
| Citations |
|---|