EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8N2 |
| Net Charge | 0 |
| Average Mass | 84.122 |
| Monoisotopic Mass | 84.06875 |
| SMILES | CN(C)CC#N |
| InChI | InChI=1S/C4H8N2/c1-6(2)4-3-5/h4H2,1-2H3 |
| InChIKey | PLXBWEPPAAQASG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| faeces (UBERON:0001988) | PubMed (17314143) | ||
| saliva (UBERON:0001836) | PubMed (24421258) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(Dimethylamino)acetonitrile (CHEBI:88381) is a tertiary amino compound (CHEBI:50996) |
| Synonyms | Source |
|---|---|
| 2-(dimethylamino)acetonitrile | HMDB |
| 2-(dimethylamino)Acetonitrile | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061875 | HMDB |
| Citations |
|---|