EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20N2O |
| Net Charge | 0 |
| Average Mass | 244.338 |
| Monoisotopic Mass | 244.15756 |
| SMILES | C=CCCN1C[C@@H]2C[C@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C15H20N2O/c1-2-3-7-16-9-12-8-13(11-16)14-5-4-6-15(18)17(14)10-12/h2,4-6,12-13H,1,3,7-11H2 |
| InChIKey | ZVTFRRVBMAUIQW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rhombifoline (CHEBI:8837) is a alkaloid (CHEBI:22315) |
| Synonyms | Source |
|---|---|
| (1R)-3-(3-Butenyl)-1,2,3,4,5,6-hexahydro-1,5-methano-8H-pyrido[1,2-a][1,4]diazocin-8-one | KEGG COMPOUND |
| Rhombifoline | KEGG COMPOUND |