EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21NO6 |
| Net Charge | 0 |
| Average Mass | 383.400 |
| Monoisotopic Mass | 383.13689 |
| SMILES | [H][C@@]12c3ccc4c(c3[C@@H](OC)O[C@]1([H])c1cc3c(cc1CCN2C)OCO3)OCO4 |
| InChI | InChI=1S/C21H21NO6/c1-22-6-5-11-7-15-16(26-9-25-15)8-13(11)19-18(22)12-3-4-14-20(27-10-24-14)17(12)21(23-2)28-19/h3-4,7-8,18-19,21H,5-6,9-10H2,1-2H3/t18-,19-,21+/m1/s1 |
| InChIKey | XRBIHOLQAKITPP-SBHAEUEKSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rhoeadine (CHEBI:8836) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| Rhoeadine | KEGG COMPOUND |