EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | CCC(O)C(O)C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-2-18(21)19(22)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-20(23)24/h3,5-6,8-9,11-12,14,18-19,21-22H,2,4,7,10,13,15-17H2,1H3,(H,23,24)/b5-3-,8-6-,11-9-,14-12- |
| InChIKey | XYDVGNAQQFWZEF-JPURVOHMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | MetaboLights (MTBLS253) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17,18-DiHETE (CHEBI:88349) has functional parent arachidonic acid (CHEBI:15843) |
| 17,18-DiHETE (CHEBI:88349) has role human blood serum metabolite (CHEBI:85234) |
| 17,18-DiHETE (CHEBI:88349) has role human xenobiotic metabolite (CHEBI:76967) |
| 17,18-DiHETE (CHEBI:88349) is a dihydroxyicosatetraenoic acid (CHEBI:72868) |
| Incoming Relation(s) |
| 17,18-DiHETE(1-) (CHEBI:747180) is conjugate base of 17,18-DiHETE (CHEBI:88349) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,14Z)-17,18-dihydroxyicosa-5,8,11,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 17,18-dihydroxyarachidonic acid | ChEBI |
| (5Z,8Z,11Z,14Z)-17,18-dihydroxyeicosa-5,8,11,14-tetraenoic acid | ChEBI |
| (5Z,8Z,11Z,14Z)-17,18-dihydroxyeicosatetraenoic acid | ChEBI |
| (5Z,8Z,11Z,14Z)-17,18-dihydroxyicosatetraenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 17220803 | ChemSpider |
| HMDB0010211 | HMDB |
| LMFA03060078 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5345124 | Reaxys |
| Citations |
|---|