EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24FN9O |
| Net Charge | 0 |
| Average Mass | 461.505 |
| Monoisotopic Mass | 461.20878 |
| SMILES | C[C@@]1(C(=O)Nc2ccc(F)nc2)CCCN1c1nc(Nc2cc(C3CC3)nn2)c2cccn2n1 |
| InChI | InChI=1S/C23H24FN9O/c1-23(21(34)26-15-7-8-18(24)25-13-15)9-3-10-32(23)22-28-20(17-4-2-11-33(17)31-22)27-19-12-16(29-30-19)14-5-6-14/h2,4,7-8,11-14H,3,5-6,9-10H2,1H3,(H,26,34)(H2,27,28,29,30,31)/t23-/m0/s1 |
| InChIKey | LQVXSNNAFNGRAH-QHCPKHFHSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BMS-754807 (CHEBI:88339) has role antineoplastic agent (CHEBI:35610) |
| BMS-754807 (CHEBI:88339) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| BMS-754807 (CHEBI:88339) is a pyrazoles (CHEBI:26410) |
| BMS-754807 (CHEBI:88339) is a pyridines (CHEBI:26421) |
| BMS-754807 (CHEBI:88339) is a pyrrolidines (CHEBI:38260) |
| BMS-754807 (CHEBI:88339) is a pyrrolotriazine (CHEBI:88341) |
| IUPAC Name |
|---|
| 1-{4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl}-N-(6-fluoropyridin-3-yl)-2-methyl-L-prolinamide |
| Synonym | Source |
|---|---|
| BMS 754807 | ChemIDplus |
| Citations |
|---|