EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N8 |
| Net Charge | 0 |
| Average Mass | 398.474 |
| Monoisotopic Mass | 398.19674 |
| SMILES | C(=NNC1=NCCN1)c1c2ccccc2c(C=NNC2=NCCN2)c2ccccc12 |
| InChI | InChI=1S/C22H22N8/c1-2-6-16-15(5-1)19(13-27-29-21-23-9-10-24-21)17-7-3-4-8-18(17)20(16)14-28-30-22-25-11-12-26-22/h1-8,13-14H,9-12H2,(H2,23,24,29)(H2,25,26,30) |
| InChIKey | NJSMWLQOCQIOPE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bisantrene (CHEBI:88337) has role antineoplastic agent (CHEBI:35610) |
| bisantrene (CHEBI:88337) is a anthracenes (CHEBI:46955) |
| bisantrene (CHEBI:88337) is a hydrazone (CHEBI:38532) |
| bisantrene (CHEBI:88337) is a imidazolidines (CHEBI:38261) |
| IUPAC Name |
|---|
| 2,2'-[anthracene-9,10-diylbis(methylylidenehydrazine-2,1-diylidene)]diimidazolidine |
| INNs | Source |
|---|---|
| bisantreno | WHO MedNet |
| bisantrenum | WHO MedNet |
| bisantrène | WHO MedNet |
| bisantrene | WHO MedNet |
| Synonym | Source |
|---|---|
| 9,10-Anthracendicarbaldehyde bis(2-imidazolin-2-ylhydrazone) | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:78186-34-2 | ChemIDplus |
| Citations |
|---|