EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25N3O3 |
| Net Charge | 0 |
| Average Mass | 391.471 |
| Monoisotopic Mass | 391.18959 |
| SMILES | Cc1cccc(C)c1OCc1cc(C(=O)N2CCC(c3ccncc3)CC2)no1 |
| InChI | InChI=1S/C23H25N3O3/c1-16-4-3-5-17(2)22(16)28-15-20-14-21(25-29-20)23(27)26-12-8-19(9-13-26)18-6-10-24-11-7-18/h3-7,10-11,14,19H,8-9,12-13,15H2,1-2H3 |
| InChIKey | WNSNPYIHDMIFOO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dafadine A (CHEBI:88327) has role geroprotector (CHEBI:176497) |
| dafadine A (CHEBI:88327) has role P450 inhibitor (CHEBI:50183) |
| dafadine A (CHEBI:88327) is a N-acylpiperidine (CHEBI:48591) |
| dafadine A (CHEBI:88327) is a aromatic amide (CHEBI:62733) |
| dafadine A (CHEBI:88327) is a aromatic ether (CHEBI:35618) |
| dafadine A (CHEBI:88327) is a isoxazoles (CHEBI:55373) |
| dafadine A (CHEBI:88327) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| {5-[(2,6-dimethylphenoxy)methyl]-1,2-oxazol-3-yl}[4-(pyridin-4-yl)piperidin-1-yl]methanone |
| Manual Xrefs | Databases |
|---|---|
| 22141101 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25668395 | Reaxys |
| Citations |
|---|