EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N3O4 |
| Net Charge | +1 |
| Average Mass | 300.294 |
| Monoisotopic Mass | 300.09788 |
| SMILES | CN(C)c1ccc2nc3c(C(N)=O)cc(O)c(O)c3[o+]c2c1 |
| InChI | InChI=1S/C15H13N3O4/c1-18(2)7-3-4-9-11(5-7)22-14-12(17-9)8(15(16)21)6-10(19)13(14)20/h3-6H,1-2H3,(H3-,16,17,19,20,21)/p+1 |
| InChIKey | FIMVKHOYPBUPQO-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gallamin blue(1+) (CHEBI:88299) has role fluorochrome (CHEBI:51217) |
| Gallamin blue(1+) (CHEBI:88299) has role histological dye (CHEBI:77178) |
| Gallamin blue(1+) (CHEBI:88299) is a organic cation (CHEBI:25697) |
| Incoming Relation(s) |
| Gallamin blue (CHEBI:88296) has part Gallamin blue(1+) (CHEBI:88299) |
| IUPAC Name |
|---|
| 1-carbamoyl-7-(dimethylamino)-3,4-dihydroxyphenoxazin-5-ium |
| Synonym | Source |
|---|---|
| Gallamin blue cation | ChEBI |