EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O7 |
| Net Charge | 0 |
| Average Mass | 516.675 |
| Monoisotopic Mass | 516.30870 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=C)C(C)C)[C@@]1(C)C[C@@H](O)[C@@]13C[C@@]14C(=O)C[C@H](O)[C@@](C)(C(=O)O)[C@]4([H])C(=O)C[C@]23O |
| InChI | InChI=1S/C30H44O7/c1-15(2)16(3)7-8-17(4)18-9-10-20-26(18,5)13-23(34)29-14-28(29)22(33)11-21(32)27(6,25(35)36)24(28)19(31)12-30(20,29)37/h15,17-18,20-21,23-24,32,34,37H,3,7-14H2,1-2,4-6H3,(H,35,36)/t17-,18-,20-,21+,23-,24+,26-,27-,28+,29+,30+/m1/s1 |
| InChIKey | JAHGNOXPMXOEJS-BSPLYONXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Preussia minima (ncbitaxon:93984) | - | PubMed (15217189) | Strain: 15604 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. EC 1.1.1.170 [3beta-hydroxysteroid-4alpha-carboxylate 3-dehydrogenase (decarboxylating)] inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of 3β-hydroxysteroid-4α-carboxylate 3-dehydrogenase (decarboxylating) (EC 1.1.1.170). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FR171456 (CHEBI:88298) has role antifungal agent (CHEBI:35718) |
| FR171456 (CHEBI:88298) has role EC 1.1.1.170 [3β-hydroxysteroid-4α-carboxylate 3-dehydrogenase (decarboxylating)] inhibitor (CHEBI:90113) |
| FR171456 (CHEBI:88298) has role ergosterol biosynthesis inhibitor (CHEBI:75282) |
| FR171456 (CHEBI:88298) has role fungal metabolite (CHEBI:76946) |
| FR171456 (CHEBI:88298) is a 11α-hydroxy steroid (CHEBI:19129) |
| FR171456 (CHEBI:88298) is a 3β-hydroxy steroid (CHEBI:36836) |
| FR171456 (CHEBI:88298) is a 6-oxo steroid (CHEBI:36883) |
| FR171456 (CHEBI:88298) is a 8-hydroxy steroid (CHEBI:139333) |
| FR171456 (CHEBI:88298) is a cyclopropanes (CHEBI:51454) |
| FR171456 (CHEBI:88298) is a steroid acid (CHEBI:47891) |
| IUPAC Name |
|---|
| 3β,8α,11α-trihydroxy-4-methyl-1,6-dioxo-9β,19-cyclo-5α-ergost-24(28)-ene-4α-carboxylic acid |
| Synonym | Source |
|---|---|
| (3β,4α,5α,8α,9β,11α)-3,8,11-trihydroxy-4-methyl-1,6-dioxo-9,19-cycloergost-24(28)-ene-4-carboxylic acid | IUPAC |
| Citations |
|---|