EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14N2O |
| Net Charge | 0 |
| Average Mass | 262.312 |
| Monoisotopic Mass | 262.11061 |
| SMILES | Cc1c2ccncc2c(C)c2c1nc1ccc(O)cc12 |
| InChI | InChI=1S/C17H14N2O/c1-9-14-8-18-6-5-12(14)10(2)17-16(9)13-7-11(20)3-4-15(13)19-17/h3-8,19-20H,1-2H3 |
| InChIKey | QZTWUDDGLIDXSE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-hydroxyellipticine (CHEBI:88297) has role antineoplastic agent (CHEBI:35610) |
| 9-hydroxyellipticine (CHEBI:88297) is a organic heterotetracyclic compound (CHEBI:38163) |
| 9-hydroxyellipticine (CHEBI:88297) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| IUPAC Name |
|---|
| 5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol |
| Synonyms | Source |
|---|---|
| 5,11-dimethyl-6H-pyrido[4,3-b]carbazol-9-ol | ChEBI |
| 9HE | ChEBI |
| 9-hydroxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazole | ChEBI |
| 9-OH-E | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:754367 | Reaxys |
| CAS:51131-85-2 | ChemIDplus |
| Citations |
|---|