EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H12O7 |
| Net Charge | 0 |
| Average Mass | 364.309 |
| Monoisotopic Mass | 364.05830 |
| SMILES | O=C1OC2(c3ccccc31)c1ccc(O)c(O)c1Oc1c2ccc(O)c1O |
| InChI | InChI=1S/C20H12O7/c21-13-7-5-11-17(15(13)23)26-18-12(6-8-14(22)16(18)24)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,21-24H |
| InChIKey | PHLYOKFVXIVOJC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | G-protein-coupled receptor antagonist An antagonist at G-protein-coupled receptor. |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gallein (CHEBI:88294) has functional parent fluoran (CHEBI:37915) |
| gallein (CHEBI:88294) has role fluorochrome (CHEBI:51217) |
| gallein (CHEBI:88294) has role G-protein-coupled receptor antagonist (CHEBI:88295) |
| gallein (CHEBI:88294) has role histological dye (CHEBI:77178) |
| gallein (CHEBI:88294) is a 2-benzofurans (CHEBI:38831) |
| gallein (CHEBI:88294) is a organic heteropentacyclic compound (CHEBI:38164) |
| gallein (CHEBI:88294) is a oxaspiro compound (CHEBI:37948) |
| gallein (CHEBI:88294) is a polyphenol (CHEBI:26195) |
| gallein (CHEBI:88294) is a xanthene dye (CHEBI:37929) |
| gallein (CHEBI:88294) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 3',4',5',6'-tetrahydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| Synonyms | Source |
|---|---|
| 3',4',5',6'-Tetrahydroxyfluoran | ChemIDplus |
| 3',4',5',6'-Tetrahydroxyspiro(isobenzofuran-1(3H),9'-(9H)xanthene)-3-one | ChemIDplus |
| 4,5-Dihydroxyfluorescein | ChemIDplus |
| Alizarin violet | ChEBI |
| C.I. 45445 | ChEBI |
| C.I. Mordant Violet 25 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:58028 | Reaxys |
| CAS:2103-64-2 | ChemIDplus |
| Citations |
|---|