EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C27H35N3.Cl |
| Net Charge | 0 |
| Average Mass | 516.955 |
| Monoisotopic Mass | 515.17029 |
| SMILES | CC[N+](C)(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(N(C)C)cc2)cc1.[Br-].[Cl-] |
| InChI | InChI=1S/C27H35N3.BrH.ClH/c1-8-30(6,7)26-19-13-23(14-20-26)27(21-9-15-24(16-10-21)28(2)3)22-11-17-25(18-12-22)29(4)5;;/h9-20H,8H2,1-7H3;2*1H/q+2;;/p-2 |
| InChIKey | IDAQSADEMXDTKN-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl green (CHEBI:88288) has part ethyl green(2+) (CHEBI:88289) |
| ethyl green (CHEBI:88288) has role fluorochrome (CHEBI:51217) |
| ethyl green (CHEBI:88288) has role histological dye (CHEBI:77178) |
| ethyl green (CHEBI:88288) is a iminium salt (CHEBI:35277) |
| ethyl green (CHEBI:88288) is a organic bromide salt (CHEBI:48369) |
| ethyl green (CHEBI:88288) is a organic chloride salt (CHEBI:36094) |
| ethyl green (CHEBI:88288) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| [4-([4-(dimethylamino)phenyl]{4-[ethyl(dimethyl)azaniumyl]phenyl}methylidene)cyclohexa-2,5-dien-1-ylidene](dimethyl)ammonium bromide chloride |
| Synonyms | Source |
|---|---|
| 4-((4-(Dimethylamino)phenyl)(4-(dimethyliminio)cyclohexa-2,5-dien-1-ylidene)methyl)-N-ethyl-N,N-dimethylanilinium bromidechloride | ChemIDplus |
| (alpha-(p-(Dimethylamino)phenyl)-alpha-(4-(methylimino)-2,5-cyclohexadien-1-ylidene)-p-tolyl)ethyldimethylammonium bromide methochloride | ChemIDplus |
| C.I. 42590 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5223468 | Reaxys |
| CAS:14855-76-6 | ChemIDplus |
| Citations |
|---|