EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H37N5O14 |
| Net Charge | 0 |
| Average Mass | 583.548 |
| Monoisotopic Mass | 583.23370 |
| SMILES | [H][C@]1([C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H](O)[C@@H]1N |
| InChI | InChI=1S/C21H37N5O14/c22-7-1-2-26(21(37)25-7)19-16(36)12(32)9(24)17(39-19)18(15(35)14(34)10(30)5(29)3-27)40-20-13(33)8(23)11(31)6(4-28)38-20/h1-2,5-6,8-20,27-36H,3-4,23-24H2,(H2,22,25,37)/t5-,6-,8+,9+,10-,11-,12+,13-,14+,15+,16-,17+,18-,19-,20+/m1/s1 |
| InChIKey | VQQSDVBOXQHCHU-SKPOXZENSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus methanolicus MGA3 (ncbitaxon:796606) | |||
| - | PubMed (26366644) | ||
| - | MetaboLights (MTBLS228) | ||
| Streptomyces longissimus (ncbitaxon:200596) | - | PubMed (903851) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antelmycin (CHEBI:88275) has functional parent cytosine (CHEBI:16040) |
| antelmycin (CHEBI:88275) has role anthelminthic drug (CHEBI:35443) |
| antelmycin (CHEBI:88275) has role bacterial metabolite (CHEBI:76969) |
| antelmycin (CHEBI:88275) has role nucleoside antibiotic (CHEBI:25605) |
| antelmycin (CHEBI:88275) is a N-glycosyl compound (CHEBI:21731) |
| antelmycin (CHEBI:88275) is a carbohydrate-containing antibiotic (CHEBI:23007) |
| antelmycin (CHEBI:88275) is a glycoside (CHEBI:24400) |
| antelmycin (CHEBI:88275) is a pyrimidone (CHEBI:38337) |
| INNs | Source |
|---|---|
| antelmycinum | ChemIDplus |
| antelmicina | ChemIDplus |
| antelmycin | ChemIDplus |
| antelmycine | ChemIDplus |
| Synonyms | Source |
|---|---|
| Anthelmycin | KEGG DRUG |
| Antibiotic 33876 | ChemIDplus |
| Hikizimycin | ChemIDplus |
| L 33876 | ChemIDplus |
| NSC 337588 | KNApSAcK |
| 1-N-(2-O-(3-Amino-3-deoxy-beta-D-glucopyranosyl)-4-amino-4-deoxy-D-glycero-D-galacto-D-gluco-beta-D-undecapyranosyl)cytosine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4284256 | Reaxys |
| CAS:12706-94-4 | KEGG DRUG |
| CAS:12706-94-4 | ChemIDplus |
| Citations |
|---|