EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18N2O7S2 |
| Net Charge | 0 |
| Average Mass | 462.505 |
| Monoisotopic Mass | 462.05554 |
| SMILES | [H][C@]12C(=COC=C[C@@H]1OC(C)=O)C[C@@]13SS[C@]4(CC5=COC=C[C@H](O)[C@@]5([H])N4C1=O)C(=O)N23 |
| InChI | InChI=1S/C20H18N2O7S2/c1-10(23)29-14-3-5-28-9-12-7-20-17(25)21-15-11(8-27-4-2-13(15)24)6-19(21,30-31-20)18(26)22(20)16(12)14/h2-5,8-9,13-16,24H,6-7H2,1H3/t13-,14-,15-,16-,19+,20+/m0/s1 |
| InChIKey | HXWOWBFXYUFFKS-PSJNWGMYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus methanolicus MGA3 (ncbitaxon:796606) | |||
| - | MetaboLights (MTBLS228) | ||
| - | PubMed (26366644) | ||
| Amauroascus aureus (ncbitaxon:113411) | - | PubMed (5735362) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antiviral agent A substance that destroys or inhibits replication of viruses. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aranotin (CHEBI:88274) has role antiviral agent (CHEBI:22587) |
| aranotin (CHEBI:88274) has role fungal metabolite (CHEBI:76946) |
| aranotin (CHEBI:88274) is a acetate ester (CHEBI:47622) |
| aranotin (CHEBI:88274) is a organic disulfide (CHEBI:35489) |
| aranotin (CHEBI:88274) is a organic heterohexacyclic compound (CHEBI:51914) |
| aranotin (CHEBI:88274) is a organonitrogen heterocyclic antibiotic (CHEBI:25558) |
| aranotin (CHEBI:88274) is a organooxygen heterocyclic antibiotic (CHEBI:25807) |
| aranotin (CHEBI:88274) is a organosulfur heterocyclic compound (CHEBI:38106) |
| aranotin (CHEBI:88274) is a oxacycle (CHEBI:38104) |
| aranotin (CHEBI:88274) is a secondary alcohol (CHEBI:35681) |
| aranotin (CHEBI:88274) is a δ-lactam (CHEBI:77727) |
| IUPAC Name |
|---|
| (5S,5aS,7aR,13S,13aS,15aR)-13-hydroxy-7,15-dioxo-5,5a,13,13a-tetrahydro-7H,8H,15H,16H-7a,15a-epidithiobisoxepino[3',4':4,5]pyrrolo[1,2-a:1',2'-d]pyrazin-5-yl acetate |
| INNs | Source |
|---|---|
| aranotin | ChemIDplus |
| aranotina | ChemIDplus |
| aranotinum | ChemIDplus |
| aranotine | ChemIDplus |
| Synonyms | Source |
|---|---|
| Lilly 53185 | ChemIDplus |
| Ariotin | ChemIDplus |
| L 53185 | ChemIDplus |
| Antibiotic A 21101-III | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3042102 | Beilstein |
| Reaxys:5421449 | Reaxys |
| CAS:19885-51-9 | ChemIDplus |
| CAS:19885-51-9 | KEGG DRUG |
| Citations |
|---|