EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:88271 - letosteine
| Formula | C10H17NO4S2 |
| Net Charge | 0 |
| Average Mass | 279.383 |
| Monoisotopic Mass | 279.05990 |
| SMILES | CCOC(=O)CSCCC1NC(C(=O)O)CS1 |
| InChI | InChI=1S/C10H17NO4S2/c1-2-15-9(12)6-16-4-3-8-11-7(5-17-8)10(13)14/h7-8,11H,2-6H2,1H3,(H,13,14) |
| InChIKey | IKOCLISPVJZJEA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus methanolicus MGA3 (ncbitaxon:796606) | |||
| - | MetaboLights (MTBLS228) | ||
| - | PubMed (26366644) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | mucolytic A compound that alters the structure of mucus so as to decrease its viscosity and thereby facilitate its removal by ciliary action and expectoration. Compare with antitussives, which suppress the cough reflex, and expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| letosteine (CHEBI:88271) has role mucolytic (CHEBI:77034) |
| letosteine (CHEBI:88271) is a aliphatic sulfide (CHEBI:22327) |
| letosteine (CHEBI:88271) is a dicarboxylic acid monoester (CHEBI:36244) |
| letosteine (CHEBI:88271) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| IUPAC Name |
|---|
| 2-{2-[(2-ethoxy-2-oxoethyl)sulfanyl]ethyl}-1,3-thiazolidine-4-carboxylic acid |
| INNs | Source |
|---|---|
| letosteine | KEGG DRUG |
| letosteinum | ChemIDplus |
| letosteine | ChemIDplus |
| letosteina | ChemIDplus |
| Synonym | Source |
|---|---|
| 2-(2-((Carboxymethyl)thio)ethyl)-4-thiazolidinecarboxylic acid 2-ethyl ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D07380 | KEGG DRUG |
| Letosteine | Wikipedia |
| US6987120 | Patent |
| DB08939 | DrugBank |
| 1555 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:999728 | Reaxys |
| CAS:53943-88-7 | KEGG DRUG |
| CAS:53943-88-7 | ChemIDplus |
| Citations |
|---|