EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N4O3S2 |
| Net Charge | 0 |
| Average Mass | 286.338 |
| Monoisotopic Mass | 286.01943 |
| SMILES | COc1nsnc1NS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C9H10N4O3S2/c1-16-9-8(11-17-12-9)13-18(14,15)7-4-2-6(10)3-5-7/h2-5H,10H2,1H3,(H,11,13) |
| InChIKey | IZOYMGQQVNAMHS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus methanolicus MGA3 (ncbitaxon:796606) | |||
| - | MetaboLights (MTBLS228) | ||
| - | PubMed (26366644) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfametrole (CHEBI:88258) has parent hydride 1,2,5-thiadiazole (CHEBI:39469) |
| sulfametrole (CHEBI:88258) is a aromatic ether (CHEBI:35618) |
| sulfametrole (CHEBI:88258) is a substituted aniline (CHEBI:48975) |
| sulfametrole (CHEBI:88258) is a sulfonamide antibiotic (CHEBI:87228) |
| sulfametrole (CHEBI:88258) is a thiadiazoles (CHEBI:38099) |
| IUPAC Name |
|---|
| 4-amino-N-(4-methoxy-1,2,5-thiadiazol-3-yl)benzene-1-sulfonamide |
| INNs | Source |
|---|---|
| sulfametrol | ChemIDplus |
| sulfametrole | ChemIDplus |
| sulfametrole | ChemIDplus |
| sulfametrolum | ChemIDplus |
| Synonym | Source |
|---|---|
| N1-(4-Methoxy-1,2,5-thiadiazol-3-yl)sulfanilamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2518 | DrugCentral |
| D08541 | KEGG DRUG |
| Sulfametrole | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:813310 | Reaxys |
| CAS:32909-92-5 | ChemIDplus |
| CAS:32909-92-5 | KEGG DRUG |
| Citations |
|---|