EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8N4O6 |
| Net Charge | 0 |
| Average Mass | 268.185 |
| Monoisotopic Mass | 268.04438 |
| SMILES | O=C1CN(/N=C/c2ccc([N+](=O)[O-])o2)C(=O)N1CO |
| InChI | InChI=1S/C9H8N4O6/c14-5-11-7(15)4-12(9(11)16)10-3-6-1-2-8(19-6)13(17)18/h1-3,14H,4-5H2/b10-3+ |
| InChIKey | UIDWQGRXEVDFCA-XCVCLJGOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus methanolicus MGA3 (ncbitaxon:796606) | |||
| - | PubMed (26366644) | ||
| - | MetaboLights (MTBLS228) |
| Roles Classification |
|---|
| Biological Roles: | hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nifurtoinol (CHEBI:88255) has functional parent semicarbazide (CHEBI:28306) |
| nifurtoinol (CHEBI:88255) has role antibacterial drug (CHEBI:36047) |
| nifurtoinol (CHEBI:88255) has role antiinfective agent (CHEBI:35441) |
| nifurtoinol (CHEBI:88255) has role hepatotoxic agent (CHEBI:50908) |
| nifurtoinol (CHEBI:88255) is a hydrazone (CHEBI:38532) |
| nifurtoinol (CHEBI:88255) is a imidazolidine-2,4-dione (CHEBI:24628) |
| nifurtoinol (CHEBI:88255) is a nitrofuran antibiotic (CHEBI:87230) |
| nifurtoinol (CHEBI:88255) is a organonitrogen heterocyclic antibiotic (CHEBI:25558) |
| IUPAC Name |
|---|
| 3-(hydroxymethyl)-1-{[(5-nitrofuran-2-yl)methylidene]amino}imidazolidine-2,4-dione |
| INNs | Source |
|---|---|
| nifurtoinol | KEGG DRUG |
| nifurtoinolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-(Hydroxymethyl)-1-(((5-nitro-2-furanyl)methylene)amino)2,4-imidazolidinedione | ChemIDplus |
| 3-(Hydroxymethyl)-1-(5-nitrofurfurylideneamino)hydantoin | ChemIDplus |
| Hydroxymethylnitrofurantoin | ChemIDplus |
| Citations |
|---|