EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14F3IN2O4 |
| Net Charge | 0 |
| Average Mass | 482.196 |
| Monoisotopic Mass | 481.99504 |
| SMILES | O=C(NOC[C@H](O)CO)c1ccc(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C16H14F3IN2O4/c17-11-3-2-10(16(25)22-26-7-9(24)6-23)15(14(11)19)21-13-4-1-8(20)5-12(13)18/h1-5,9,21,23-24H,6-7H2,(H,22,25)/t9-/m1/s1 |
| InChIKey | SUDAHWBOROXANE-SECBINFHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.12.2 (mitogen-activated protein kinase kinase) inhibitor An EC 2.7.12.* [dual-specificity kinases (those acting on Ser/Thr and Tyr residues)] inhibitor that inhibits the action of mitogen-activated protein kinase kinase (EC 2.7.12.2). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PD 0325901 (CHEBI:88249) has role antineoplastic agent (CHEBI:35610) |
| PD 0325901 (CHEBI:88249) has role EC 2.7.12.2 (mitogen-activated protein kinase kinase) inhibitor (CHEBI:88286) |
| PD 0325901 (CHEBI:88249) is a difluorobenzene (CHEBI:38582) |
| PD 0325901 (CHEBI:88249) is a hydroxamic acid ester (CHEBI:75606) |
| PD 0325901 (CHEBI:88249) is a monofluorobenzenes (CHEBI:83575) |
| PD 0325901 (CHEBI:88249) is a organoiodine compound (CHEBI:37142) |
| PD 0325901 (CHEBI:88249) is a propane-1,2-diols (CHEBI:26284) |
| PD 0325901 (CHEBI:88249) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N-[(2R)-2,3-dihydroxypropoxy]-3,4-difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzamide |
| Synonyms | Source |
|---|---|
| PD-0325901 | ChEBI |
| PD0325901 | ChemIDplus |
| PD 325901 | ChemIDplus |
| PD-325901 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-1101 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11343179 | Reaxys |
| CAS:391210-10-9 | ChemIDplus |
| Citations |
|---|