EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25N3O5 |
| Net Charge | 0 |
| Average Mass | 375.425 |
| Monoisotopic Mass | 375.17942 |
| SMILES | NCc1cc(COc2ccc(CCNC(=O)CC[C@H](N)C(=O)O)cc2)co1 |
| InChI | InChI=1S/C19H25N3O5/c20-10-16-9-14(12-27-16)11-26-15-3-1-13(2-4-15)7-8-22-18(23)6-5-17(21)19(24)25/h1-4,9,12,17H,5-8,10-11,20-21H2,(H,22,23)(H,24,25)/t17-/m0/s1 |
| InChIKey | NYIWEBCNBZGUSO-KRWDZBQOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Methanocaldococcus jannaschii (ncbitaxon:2190) | - | PubMed (26100040) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4-{4-[2-(γ-L-glutamylamino)ethyl]phenoxymethyl}furan-2-yl)methanamine (CHEBI:88248) has role bacterial metabolite (CHEBI:76969) |
| (4-{4-[2-(γ-L-glutamylamino)ethyl]phenoxymethyl}furan-2-yl)methanamine (CHEBI:88248) is a L-glutamine derivative (CHEBI:24317) |
| (4-{4-[2-(γ-L-glutamylamino)ethyl]phenoxymethyl}furan-2-yl)methanamine (CHEBI:88248) is a aromatic ether (CHEBI:35618) |
| (4-{4-[2-(γ-L-glutamylamino)ethyl]phenoxymethyl}furan-2-yl)methanamine (CHEBI:88248) is a furans (CHEBI:24129) |
| (4-{4-[2-(γ-L-glutamylamino)ethyl]phenoxymethyl}furan-2-yl)methanamine (CHEBI:88248) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| N-[2-(4-{[5-(aminomethyl)furan-3-yl]methoxy}phenyl)ethyl]-L-glutamine |
| Manual Xrefs | Databases |
|---|---|
| CPD-7646 | MetaCyc |
| Citations |
|---|