EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24O9 |
| Net Charge | 0 |
| Average Mass | 420.414 |
| Monoisotopic Mass | 420.14203 |
| SMILES | COc1ccc(/C=C/c2cc(O)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1O |
| InChI | InChI=1S/C21H24O9/c1-28-16-5-4-11(8-15(16)24)2-3-12-6-13(23)9-14(7-12)29-21-20(27)19(26)18(25)17(10-22)30-21/h2-9,17-27H,10H2,1H3/b3-2+/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | GKAJCVFOJGXVIA-DXKBKAGUSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rheum palmatum (ncbitaxon:137221) | rhizome (BTO:0001181) | PubMed (33088192) | |
| Rheum rhabarbarum (ncbitaxon:3621) | root (BTO:0001188) | DOI (10.1094/PDIS-07-18-1168-RE) | |
| Rheum rhaponticum (ncbitaxon:46087) | - | DOI (10.1007/s00217-008-0922-y) | |
| Rheum tanguticum (ncbitaxon:137226) | - | DOI (10.1039/C3FO60484E) | |
| Rheum undulatum (ncbitaxon:137227) | - | PubMed (30015877) | |
| Trigonella foenum-graecum (ncbitaxon:78534) | seed (BTO:0001226) | PubMed (26598549) | |
| Vitis vinifera (ncbitaxon:29760) | leaf (BTO:0000713) | PubMed (32397203) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.3.1.85 (fatty acid synthase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of fatty acid synthase (EC 2.3.1.85), a multi-enzyme protein involved in fatty acid synthesis. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). anti-inflammatory agent Any compound that has anti-inflammatory effects. anti-allergic agent A drug used to treat allergic reactions. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-rhaponticin (CHEBI:8824) has functional parent rhapontigenin (CHEBI:174376) |
| trans-rhaponticin (CHEBI:8824) has role angiogenesis inhibitor (CHEBI:48422) |
| trans-rhaponticin (CHEBI:8824) has role anti-allergic agent (CHEBI:50857) |
| trans-rhaponticin (CHEBI:8824) has role anti-inflammatory agent (CHEBI:67079) |
| trans-rhaponticin (CHEBI:8824) has role antilipemic drug (CHEBI:35679) |
| trans-rhaponticin (CHEBI:8824) has role antineoplastic agent (CHEBI:35610) |
| trans-rhaponticin (CHEBI:8824) has role apoptosis inducer (CHEBI:68495) |
| trans-rhaponticin (CHEBI:8824) has role EC 2.3.1.85 (fatty acid synthase) inhibitor (CHEBI:71476) |
| trans-rhaponticin (CHEBI:8824) has role hypoglycemic agent (CHEBI:35526) |
| trans-rhaponticin (CHEBI:8824) has role neuroprotective agent (CHEBI:63726) |
| trans-rhaponticin (CHEBI:8824) has role plant metabolite (CHEBI:76924) |
| trans-rhaponticin (CHEBI:8824) is a rhaponticin (CHEBI:92176) |
| Incoming Relation(s) |
| 6-O-malonyl-trans-rhaponticin (CHEBI:177370) has functional parent trans-rhaponticin (CHEBI:8824) |
| IUPAC Name |
|---|
| 3-hydroxy-5-[(E)-2-(3-hydroxy-4-methoxyphenyl)ethenyl]phenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| (2S,3R,4S,5S,6R)-2-{3-hydroxy-5-[(E)-2-(3-hydroxy-4-methoxyphenyl)ethenyl]phenoxy}-6-(hydroxymethyl)oxane-3,4,5-triol | IUPAC |
| (2S,3R,4S,5S,6R)-2-{3-hydroxy-5-[(E)-2-(3-hydroxy-4-methoxyphenyl)ethenyl]phenoxy}-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol | IUPAC |
| (E)-rhaponticin | ChEBI |
| ponticin | ChemIDplus |
| rhaponticin | ChemIDplus |
| rhaponticine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| rhaponticin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00002904 | KNApSAcK |
| C10288 | KEGG COMPOUND |
| FDB008525 | FooDB |
| LMPK13090002 | LIPID MAPS |
| Rhaponticin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:155-58-8 | ChemIDplus |
| Citations |
|---|