EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8824 - trans-rhaponticin
| Formula | C21H24O9 |
| Net Charge | 0 |
| Average Mass | 420.414 |
| Monoisotopic Mass | 420.14203 |
| SMILES | COc1ccc(/C=C/c2cc(O)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1O |
| InChI | InChI=1S/C21H24O9/c1-28-16-5-4-11(8-15(16)24)2-3-12-6-13(23)9-14(7-12)29-21-20(27)19(26)18(25)17(10-22)30-21/h2-9,17-27H,10H2,1H3/b3-2+/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | GKAJCVFOJGXVIA-DXKBKAGUSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rheum palmatum (ncbitaxon:137221) | rhizome (BTO:0001181) | PubMed (33088192) | |
| Rheum rhabarbarum (ncbitaxon:3621) | root (BTO:0001188) | DOI (10.1094/PDIS-07-18-1168-RE) | |
| Rheum rhaponticum (ncbitaxon:46087) | - | DOI (10.1007/s00217-008-0922-y) | |
| Rheum tanguticum (ncbitaxon:137226) | - | DOI (10.1039/C3FO60484E) | |
| Rheum undulatum (ncbitaxon:137227) | - | PubMed (30015877) | |
| Trigonella foenum-graecum (ncbitaxon:78534) | seed (BTO:0001226) | PubMed (26598549) | |
| Vitis vinifera (ncbitaxon:29760) | leaf (BTO:0000713) | PubMed (32397203) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.3.1.85 (fatty acid synthase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of fatty acid synthase (EC 2.3.1.85), a multi-enzyme protein involved in fatty acid synthesis. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. anti-allergic agent A drug used to treat allergic reactions. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. hypoglycemic agent A drug which lowers the blood glucose level. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-rhaponticin (CHEBI:8824) has functional parent rhapontigenin (CHEBI:174376) |
| trans-rhaponticin (CHEBI:8824) has role angiogenesis inhibitor (CHEBI:48422) |
| trans-rhaponticin (CHEBI:8824) has role anti-allergic agent (CHEBI:50857) |
| trans-rhaponticin (CHEBI:8824) has role anti-inflammatory agent (CHEBI:67079) |
| trans-rhaponticin (CHEBI:8824) has role antilipemic drug (CHEBI:35679) |
| trans-rhaponticin (CHEBI:8824) has role antineoplastic agent (CHEBI:35610) |
| trans-rhaponticin (CHEBI:8824) has role apoptosis inducer (CHEBI:68495) |
| trans-rhaponticin (CHEBI:8824) has role EC 2.3.1.85 (fatty acid synthase) inhibitor (CHEBI:71476) |
| trans-rhaponticin (CHEBI:8824) has role hypoglycemic agent (CHEBI:35526) |
| trans-rhaponticin (CHEBI:8824) has role neuroprotective agent (CHEBI:63726) |
| trans-rhaponticin (CHEBI:8824) has role plant metabolite (CHEBI:76924) |
| trans-rhaponticin (CHEBI:8824) is a rhaponticin (CHEBI:92176) |
| Incoming Relation(s) |
| 6-O-malonyl-trans-rhaponticin (CHEBI:177370) has functional parent trans-rhaponticin (CHEBI:8824) |
| IUPAC Name |
|---|
| 3-hydroxy-5-[(E)-2-(3-hydroxy-4-methoxyphenyl)ethenyl]phenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| (2S,3R,4S,5S,6R)-2-{3-hydroxy-5-[(E)-2-(3-hydroxy-4-methoxyphenyl)ethenyl]phenoxy}-6-(hydroxymethyl)oxane-3,4,5-triol | IUPAC |
| (2S,3R,4S,5S,6R)-2-{3-hydroxy-5-[(E)-2-(3-hydroxy-4-methoxyphenyl)ethenyl]phenoxy}-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol | IUPAC |
| (E)-rhaponticin | ChEBI |
| ponticin | ChemIDplus |
| rhaponticin | ChemIDplus |
| rhaponticine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| rhaponticin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00002904 | KNApSAcK |
| C10288 | KEGG COMPOUND |
| FDB008525 | FooDB |
| LMPK13090002 | LIPID MAPS |
| Rhaponticin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:155-58-8 | ChemIDplus |
| Citations |
|---|