EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H23N5O3 |
| Net Charge | 0 |
| Average Mass | 465.513 |
| Monoisotopic Mass | 465.18009 |
| SMILES | [H][C@@]12C[C@](N)(C(=O)NC)[C@@](C)(O1)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 |
| InChI | InChI=1S/C27H23N5O3/c1-26-27(28,25(34)29-2)11-18(35-26)31-16-9-5-3-7-13(16)20-21-15(12-30-24(21)33)19-14-8-4-6-10-17(14)32(26)23(19)22(20)31/h3-10,18H,11-12,28H2,1-2H3,(H,29,34)(H,30,33)/t18-,26+,27-/m0/s1 |
| InChIKey | DCAYZGCTSXLIHO-FYCNXDEQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TTT-3002 (CHEBI:88219) has role antineoplastic agent (CHEBI:35610) |
| TTT-3002 (CHEBI:88219) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| TTT-3002 (CHEBI:88219) is a bridged compound (CHEBI:35990) |
| TTT-3002 (CHEBI:88219) is a hemiaminal (CHEBI:73080) |
| TTT-3002 (CHEBI:88219) is a indolocarbazole (CHEBI:51915) |
| TTT-3002 (CHEBI:88219) is a monocarboxylic acid amide (CHEBI:29347) |
| TTT-3002 (CHEBI:88219) is a organic heterooctacyclic compound (CHEBI:38165) |
| TTT-3002 (CHEBI:88219) is a primary amino compound (CHEBI:50994) |
| TTT-3002 (CHEBI:88219) is a γ-lactam (CHEBI:74222) |
| IUPAC Name |
|---|
| (5R,6R,8S)-6-amino-N,5-dimethyl-13-oxo-5,6,7,8,14,15-hexahydro-13H-5,8-epoxy-4b,8a,14-triazadibenzo[b,h]cycloocta[1,2,3,4-jkl]cyclopenta[e]-as-indacene-6-carboxamide |
| Synonyms | Source |
|---|---|
| TTT 3002 | ChEBI |
| TTT3002 | ChEBI |
| Citations |
|---|