EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H28F2N2O12 |
| Net Charge | 0 |
| Average Mass | 694.596 |
| Monoisotopic Mass | 694.16103 |
| SMILES | COc1ccc(N(CC(=O)O)CC(=O)O)c(OCCOc2cc(-c3c4cc(F)c(=O)cc-4oc4cc(O)c(F)cc34)ccc2NCC(=O)O)c1 |
| InChI | InChI=1S/C34H28F2N2O12/c1-47-18-3-5-24(38(15-32(43)44)16-33(45)46)30(9-18)49-7-6-48-29-8-17(2-4-23(29)37-14-31(41)42)34-19-10-21(35)25(39)12-27(19)50-28-13-26(40)22(36)11-20(28)34/h2-5,8-13,37,39H,6-7,14-16H2,1H3,(H,41,42)(H,43,44)(H,45,46) |
| InChIKey | UUAQRSIXJGAQGA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. visual indicator Anything used in a scientific experiment that gives a visual change to indicate the presence of a substance or quality, change in a body, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FluoZin-3 (CHEBI:88218) has role chelator (CHEBI:38161) |
| FluoZin-3 (CHEBI:88218) has role histological dye (CHEBI:77178) |
| FluoZin-3 (CHEBI:88218) has role visual indicator (CHEBI:50408) |
| FluoZin-3 (CHEBI:88218) is a aromatic ether (CHEBI:35618) |
| FluoZin-3 (CHEBI:88218) is a cyclic ketone (CHEBI:3992) |
| FluoZin-3 (CHEBI:88218) is a organofluorine compound (CHEBI:37143) |
| FluoZin-3 (CHEBI:88218) is a phenols (CHEBI:33853) |
| FluoZin-3 (CHEBI:88218) is a substituted aniline (CHEBI:48975) |
| FluoZin-3 (CHEBI:88218) is a tricarboxylic acid (CHEBI:27093) |
| FluoZin-3 (CHEBI:88218) is a xanthenes (CHEBI:38835) |
| IUPAC Name |
|---|
| N-[2-(2-{2-[bis(carboxymethyl)amino]-5-methoxyphenoxy}ethoxy)-4-(2,7-difluoro-6-hydroxy-3-oxo-3H-xanthen-9-yl)phenyl]glycine |
| Citations |
|---|