EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H28F2N2O12 |
| Net Charge | 0 |
| Average Mass | 694.596 |
| Monoisotopic Mass | 694.16103 |
| SMILES | COc1ccc(N(CC(=O)O)CC(=O)O)c(OCCOc2cc(-c3c4cc(F)c(=O)cc-4oc4cc(O)c(F)cc34)ccc2NCC(=O)O)c1 |
| InChI | InChI=1S/C34H28F2N2O12/c1-47-18-3-5-24(38(15-32(43)44)16-33(45)46)30(9-18)49-7-6-48-29-8-17(2-4-23(29)37-14-31(41)42)34-19-10-21(35)25(39)12-27(19)50-28-13-26(40)22(36)11-20(28)34/h2-5,8-13,37,39H,6-7,14-16H2,1H3,(H,41,42)(H,43,44)(H,45,46) |
| InChIKey | UUAQRSIXJGAQGA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | visual indicator Anything used in a scientific experiment that gives a visual change to indicate the presence of a substance or quality, change in a body, etc. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FluoZin-3 (CHEBI:88218) has role chelator (CHEBI:38161) |
| FluoZin-3 (CHEBI:88218) has role histological dye (CHEBI:77178) |
| FluoZin-3 (CHEBI:88218) has role visual indicator (CHEBI:50408) |
| FluoZin-3 (CHEBI:88218) is a aromatic ether (CHEBI:35618) |
| FluoZin-3 (CHEBI:88218) is a cyclic ketone (CHEBI:3992) |
| FluoZin-3 (CHEBI:88218) is a organofluorine compound (CHEBI:37143) |
| FluoZin-3 (CHEBI:88218) is a phenols (CHEBI:33853) |
| FluoZin-3 (CHEBI:88218) is a substituted aniline (CHEBI:48975) |
| FluoZin-3 (CHEBI:88218) is a tricarboxylic acid (CHEBI:27093) |
| FluoZin-3 (CHEBI:88218) is a xanthenes (CHEBI:38835) |
| IUPAC Name |
|---|
| N-[2-(2-{2-[bis(carboxymethyl)amino]-5-methoxyphenoxy}ethoxy)-4-(2,7-difluoro-6-hydroxy-3-oxo-3H-xanthen-9-yl)phenyl]glycine |
| Citations |
|---|