EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28N6 |
| Net Charge | 0 |
| Average Mass | 424.552 |
| Monoisotopic Mass | 424.23754 |
| SMILES | c1ccc(CN(CCN(Cc2ccccn2)Cc2ccccn2)Cc2ccccn2)nc1 |
| InChI | InChI=1S/C26H28N6/c1-5-13-27-23(9-1)19-31(20-24-10-2-6-14-28-24)17-18-32(21-25-11-3-7-15-29-25)22-26-12-4-8-16-30-26/h1-16H,17-22H2 |
| InChIKey | CVRXLMUYFMERMJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. copper chelator A chelator that is any compound containing a ligand (typically organic) which is able to form a bond to a central copper atom at two or more points. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N,N',N'-tetrakis(2-pyridylmethyl)ethylenediamine (CHEBI:88217) has functional parent ethylenediamine (CHEBI:30347) |
| N,N,N',N'-tetrakis(2-pyridylmethyl)ethylenediamine (CHEBI:88217) has role apoptosis inducer (CHEBI:68495) |
| N,N,N',N'-tetrakis(2-pyridylmethyl)ethylenediamine (CHEBI:88217) has role chelator (CHEBI:38161) |
| N,N,N',N'-tetrakis(2-pyridylmethyl)ethylenediamine (CHEBI:88217) has role copper chelator (CHEBI:166831) |
| N,N,N',N'-tetrakis(2-pyridylmethyl)ethylenediamine (CHEBI:88217) is a N-substituted diamine (CHEBI:50441) |
| N,N,N',N'-tetrakis(2-pyridylmethyl)ethylenediamine (CHEBI:88217) is a pyridines (CHEBI:26421) |
| N,N,N',N'-tetrakis(2-pyridylmethyl)ethylenediamine (CHEBI:88217) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N1,N1,N2,N2-tetrakis[(pyridin-2-yl)methyl]ethane-1,2-diamine |
| Synonym | Source |
|---|---|
| TPEN | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-19976 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4211982 | Reaxys |
| CAS:16858-02-9 | ChemIDplus |
| Citations |
|---|