EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H24N6 |
| Net Charge | 0 |
| Average Mass | 456.553 |
| Monoisotopic Mass | 456.20624 |
| SMILES | CC1(C)Nc2cccc3c(N=Nc4ccc(N=Nc5ccccc5)c5ccccc45)ccc(c23)N1 |
| InChI | InChI=1S/C29H24N6/c1-29(2)30-26-14-8-13-22-25(17-18-27(31-29)28(22)26)35-34-24-16-15-23(20-11-6-7-12-21(20)24)33-32-19-9-4-3-5-10-19/h3-18,30-31H,1-2H3 |
| InChIKey | YCUVUDODLRLVIC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sudan black B (CHEBI:88216) has role histological dye (CHEBI:77178) |
| Sudan black B (CHEBI:88216) is a azobenzenes (CHEBI:22682) |
| Sudan black B (CHEBI:88216) is a bis(azo) compound (CHEBI:48960) |
| Sudan black B (CHEBI:88216) is a perimidines (CHEBI:39204) |
| IUPAC Name |
|---|
| 2,2-dimethyl-6-{[4-(phenyldiazenyl)naphthalen-1-yl]diazenyl}-2,3-dihydro-1H-perimidine |
| Synonyms | Source |
|---|---|
| C.I. 26150 | ChEBI |
| Fat black HB | ChEBI |
| Solvent black 3 | ChEBI |
| Fast Black HB | ChemIDplus |
| 2,3-Dihydro-2,2-dimethyl-6-((4-(phenylazo)-1-naphthalenyl)azo)-1H-pyrimidine | ChemIDplus |
| C.I. Solvent Black 3 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Sudan_Black_B | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:723248 | Reaxys |
| CAS:4197-25-5 | ChemIDplus |
| Citations |
|---|