EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H31N3.HCl |
| Net Charge | 0 |
| Average Mass | 422.016 |
| Monoisotopic Mass | 421.22848 |
| SMILES | CCN=C1C=CC(=C(c2ccc(NCC)cc2)c2ccc(NCC)c(C)c2)C=C1.Cl |
| InChI | InChI=1S/C26H31N3.ClH/c1-5-27-23-13-8-20(9-14-23)26(21-10-15-24(16-11-21)28-6-2)22-12-17-25(29-7-3)19(4)18-22;/h8-18,27,29H,5-7H2,1-4H3;1H/b26-21-,28-24+; |
| InChIKey | OKNJKIKBMQYONP-ZTFPKQFBSA-N |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hoffman's violet (CHEBI:88205) has role fluorochrome (CHEBI:51217) |
| Hoffman's violet (CHEBI:88205) has role histological dye (CHEBI:77178) |
| Hoffman's violet (CHEBI:88205) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N-ethyl-4-{[4-(ethylamino)phenyl][4-(ethylimino)cyclohexa-2,5-dien-1-ylidene]methyl}-2-methylaniline hydrochloride |
| Synonyms | Source |
|---|---|
| C.I. 42530 | ChEBI |
| Hofman's Violet | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:8004-86-2 | ChemIDplus |
| Citations |
|---|