EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O5 |
| Net Charge | 0 |
| Average Mass | 396.443 |
| Monoisotopic Mass | 396.16852 |
| SMILES | [H][C@]1(N[C@@H](CCc2ccccc2)C(=O)O)CCc2ccccc2N(CC(=O)O)C1=O |
| InChI | InChI=1S/C22H24N2O5/c25-20(26)14-24-19-9-5-4-8-16(19)11-13-17(21(24)27)23-18(22(28)29)12-10-15-6-2-1-3-7-15/h1-9,17-18,23H,10-14H2,(H,25,26)(H,28,29)/t17-,18-/m0/s1 |
| InChIKey | MADRIHWFJGRSBP-ROUUACIJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Application: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benazeprilat (CHEBI:88200) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| benazeprilat (CHEBI:88200) is a benzazepine (CHEBI:35676) |
| benazeprilat (CHEBI:88200) is a dicarboxylic acid (CHEBI:35692) |
| benazeprilat (CHEBI:88200) is a lactam (CHEBI:24995) |
| Incoming Relation(s) |
| benazepril (CHEBI:3011) has functional parent benazeprilat (CHEBI:88200) |
| IUPAC Name |
|---|
| (2S)-2-{[(3S)-1-(carboxymethyl)-2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl]amino}-4-phenylbutanoic acid |
| INNs | Source |
|---|---|
| benazeprilat | IUPAC |
| benazeprilatum | IUPAC |
| benazeprilat | IUPAC |
| bénazéprilate | IUPAC |
| Synonyms | Source |
|---|---|
| CGS 14831 | ChemIDplus |
| (3S)-3-(((1S)-1-carboxy-3-phenylpropyl)amino)-2,3,4,5-tetrahydro-2-oxo-1H-1-benzazepine-1-acetic acid | ChemIDplus |
| benazepril diacid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D03077 | KEGG DRUG |
| HMDB0060582 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4214792 | Reaxys |
| CAS:86541-78-8 | ChemIDplus |