EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N3O4.Cl |
| Net Charge | 0 |
| Average Mass | 363.801 |
| Monoisotopic Mass | 363.09858 |
| SMILES | CCN(CC)c1ccc2nc3c(C(N)=O)cc(O)c(O)c3[o+]c2c1.[Cl-] |
| InChI | InChI=1S/C17H17N3O4.ClH/c1-3-20(4-2)9-5-6-11-13(7-9)24-16-14(19-11)10(17(18)23)8-12(21)15(16)22;/h5-8H,3-4H2,1-2H3,(H3-,18,19,21,22,23);1H |
| InChIKey | VXAFJUDTZSMEFN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Celestin blue B (CHEBI:88183) has part Celestin blue B(1+) (CHEBI:88189) |
| Celestin blue B (CHEBI:88183) has role fluorochrome (CHEBI:51217) |
| Celestin blue B (CHEBI:88183) has role histological dye (CHEBI:77178) |
| Celestin blue B (CHEBI:88183) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 1-carbamoyl-7-(diethylamino)-3,4-dihydroxyphenoxazin-5-ium chloride |
| Synonyms | Source |
|---|---|
| 1-Carbamoyl-7-(diethylamino)-3,4-dihydroxyphenoxazinium chloride | ChemIDplus |
| Celestin blue | ChEBI |
| C.I. 51050 | ChEBI |
| C.I. Mordant Blue 14 | ChemIDplus |
| Coelestin blue | ChEBI |
| Coreine Blue B | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3830911 | Reaxys |
| CAS:1562-90-9 | ChemIDplus |
| Citations |
|---|