EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H17N |
| Net Charge | 0 |
| Average Mass | 115.220 |
| Monoisotopic Mass | 115.13610 |
| SMILES | CCCN(CC)CC |
| InChI | InChI=1S/C7H17N/c1-4-7-8(5-2)6-3/h4-7H2,1-3H3 |
| InChIKey | PQZTVWVYCLIIJY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (26175011) | ||
| - | MetaboLights (MTBLS226) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diethyl(propyl)amine (CHEBI:88180) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| N,N-diethylpropan-1-amine |
| Synonyms | Source |
|---|---|
| Diethyl-n-propylamine | NIST Chemistry WebBook |
| diethylpropylamine | ChEBI |
| N,N-diethylpropylamine | ChEBI |
| N-propyldiethylamine | ChEBI |
| N,N-Diethyl-n-propylamine | NIST Chemistry WebBook |
| N-(n-Propyl)diethylamine | NIST Chemistry WebBook |