EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9NO7S |
| Net Charge | 0 |
| Average Mass | 335.293 |
| Monoisotopic Mass | 335.00997 |
| SMILES | Nc1c(O)c(S(=O)(=O)O)c(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H9NO7S/c15-9-7-8(12(18)14(13(9)19)23(20,21)22)11(17)6-4-2-1-3-5(6)10(7)16/h1-4,18-19H,15H2,(H,20,21,22) |
| InChIKey | AMXZGMCPHWGQGT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nuclear fast red free acid (CHEBI:88179) has role fluorochrome (CHEBI:51217) |
| nuclear fast red free acid (CHEBI:88179) has role histological dye (CHEBI:77178) |
| nuclear fast red free acid (CHEBI:88179) is a arenesulfonic acid (CHEBI:33555) |
| nuclear fast red free acid (CHEBI:88179) is a dihydroxyanthraquinone (CHEBI:37484) |
| nuclear fast red free acid (CHEBI:88179) is a primary arylamine (CHEBI:50471) |
| nuclear fast red free acid (CHEBI:88179) is conjugate acid of nuclear fast red(1−) (CHEBI:88181) |
| Incoming Relation(s) |
| nuclear fast red(1−) (CHEBI:88181) is conjugate base of nuclear fast red free acid (CHEBI:88179) |
| IUPAC Name |
|---|
| 4-amino-1,3-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid |
| Synonyms | Source |
|---|---|
| nuclear fast red (acid form) | ChEBI |
| calcium red (acid form) | ChEBI |
| calcium red free acid | ChEBI |
| 4-amino-1,3-dihydroxy-9,10-anthraquinone-2-sulfonate | ChEBI |