EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8NO7S.Na |
| Net Charge | 0 |
| Average Mass | 357.275 |
| Monoisotopic Mass | 356.99192 |
| SMILES | Nc1c(O)c(S(=O)(=O)[O-])c(O)c2c1C(=O)c1ccccc1C2=O.[Na+] |
| InChI | InChI=1S/C14H9NO7S.Na/c15-9-7-8(12(18)14(13(9)19)23(20,21)22)11(17)6-4-2-1-3-5(6)10(7)16;/h1-4,18-19H,15H2,(H,20,21,22);/q;+1/p-1 |
| InChIKey | IFSXZLJQEKGQAF-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nuclear fast red (CHEBI:88178) has part nuclear fast red(1−) (CHEBI:88181) |
| nuclear fast red (CHEBI:88178) has role fluorochrome (CHEBI:51217) |
| nuclear fast red (CHEBI:88178) has role histological dye (CHEBI:77178) |
| nuclear fast red (CHEBI:88178) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 4-amino-1,3-dihydroxy-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate |
| Synonyms | Source |
|---|---|
| calcium red | ChEBI |
| C.I. 60760 | ChEBI |
| Helio fast rubin BBL | ChEBI |
| Kernechtrot | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20093893 | Reaxys |
| CAS:6409-77-4 | ChemIDplus |