EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C17H20N3O.Cl4Zn |
| Net Charge | 0 |
| Average Mass | 771.936 |
| Monoisotopic Mass | 768.12583 |
| SMILES | CCN(CC)c1ccc2nc3cc(C)c(N)cc3[o+]c2c1.CCN(CC)c1ccc2nc3cc(C)c(N)cc3[o+]c2c1.[Cl][Zn-2]([Cl])([Cl])[Cl] |
| InChI | InChI=1S/2C17H20N3O.4ClH.Zn/c2*1-4-20(5-2)12-6-7-14-16(9-12)21-17-10-13(18)11(3)8-15(17)19-14;;;;;/h2*6-10H,4-5,18H2,1-3H3;4*1H;/q2*+1;;;;;+2/p-4 |
| InChIKey | SIHASHFMDFXGSX-UHFFFAOYSA-J |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brilliant cresyl blue (CHEBI:88168) has part brilliant cresyl blue(1+) (CHEBI:88171) |
| brilliant cresyl blue (CHEBI:88168) has role fluorochrome (CHEBI:51217) |
| brilliant cresyl blue (CHEBI:88168) has role histological dye (CHEBI:77178) |
| brilliant cresyl blue (CHEBI:88168) is a organic tetrachlorozincate salt (CHEBI:88169) |
| IUPAC Name |
|---|
| bis[3-amino-7-(diethylamino)-2-methylphenoxazin-5-ium] tetrachlorozincate(2−) |
| Synonyms | Source |
|---|---|
| C.I. 51010 | ChEBI |
| Cresyl blue | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Brilliant_cresyl_blue | Wikipedia |
| Citations |
|---|