EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N2O2 |
| Net Charge | 0 |
| Average Mass | 132.163 |
| Monoisotopic Mass | 132.08988 |
| SMILES | CN(C)CC(N)C(=O)O |
| InChI | InChI=1S/C5H12N2O2/c1-7(2)3-4(6)5(8)9/h4H,3,6H2,1-2H3,(H,8,9) |
| InChIKey | KEZRWUUMKVVUPT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-azaleucine (CHEBI:88163) is a alanine derivative (CHEBI:22278) |
| 4-azaleucine (CHEBI:88163) is a leucine derivative (CHEBI:47003) |
| 4-azaleucine (CHEBI:88163) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 4-azaleucine (CHEBI:88163) is a tertiary amino compound (CHEBI:50996) |
| Synonym | Source |
|---|---|
| 4-aza-DL-leucine | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1941 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3932032 | Reaxys |