EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO4 |
| Net Charge | 0 |
| Average Mass | 225.244 |
| Monoisotopic Mass | 225.10011 |
| SMILES | COc1c(C)cc(C[C@H](N)C(=O)O)cc1O |
| InChI | InChI=1S/C11H15NO4/c1-6-3-7(4-8(12)11(14)15)5-9(13)10(6)16-2/h3,5,8,13H,4,12H2,1-2H3,(H,14,15)/t8-/m0/s1 |
| InChIKey | WCPBEUSWIVLNSK-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces lavendulae (ncbitaxon:1914) | - | PubMed (22187429) | Strain: NRRL 11002 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-O,5-dimethyl-L-tyrosine (CHEBI:88159) has role bacterial metabolite (CHEBI:76969) |
| 3-hydroxy-O,5-dimethyl-L-tyrosine (CHEBI:88159) is a L-tyrosine derivative (CHEBI:27177) |
| 3-hydroxy-O,5-dimethyl-L-tyrosine (CHEBI:88159) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 3-hydroxy-O,5-dimethyl-L-tyrosine (CHEBI:88159) is tautomer of 3-hydroxy-O,5-dimethyl-L-tyrosine zwitterion (CHEBI:87846) |
| Incoming Relation(s) |
| 3-hydroxy-O,5-dimethyl-L-tyrosine zwitterion (CHEBI:87846) is tautomer of 3-hydroxy-O,5-dimethyl-L-tyrosine (CHEBI:88159) |
| IUPAC Name |
|---|
| 3-hydroxy-O,5-dimethyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| 3-hydroxy-4-methoxy-5-methylphenylalanine | ChEBI |
| 3-hydroxy-4-methoxy-5-methyl-L-phenylalanine | ChEBI |
| 3-hydroxy-5-methyl-O-methyltyrosine | MetaCyc |
| 3-hydroxy-O,5-dimethyltyrosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-18029 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9706701 | Reaxys |
| Citations |
|---|