EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H6O4 |
| Net Charge | 0 |
| Average Mass | 202.165 |
| Monoisotopic Mass | 202.02661 |
| SMILES | O=C(O)C1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H6O4/c12-9-5-8(11(14)15)10(13)7-4-2-1-3-6(7)9/h1-5H,(H,14,15) |
| InChIKey | UZSCBEJDBQICON-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,4-naphthoquinone-2-carboxylic acid (CHEBI:88158) has functional parent 1,4-naphthoquinone (CHEBI:27418) |
| 1,4-naphthoquinone-2-carboxylic acid (CHEBI:88158) is a 1,4-naphthoquinones (CHEBI:132142) |
| 1,4-naphthoquinone-2-carboxylic acid (CHEBI:88158) is a dioxo monocarboxylic acid (CHEBI:35951) |
| 1,4-naphthoquinone-2-carboxylic acid (CHEBI:88158) is conjugate acid of 1,4-naphthoquinone-2-carboxylate (CHEBI:87842) |
| Incoming Relation(s) |
| 1,4-naphthoquinone-2-carboxylate (CHEBI:87842) is conjugate base of 1,4-naphthoquinone-2-carboxylic acid (CHEBI:88158) |
| IUPAC Name |
|---|
| 1,4-dioxo-1,4-dihydronaphthalene-2-carboxylic acid |
| Synonym | Source |
|---|---|
| 2-carboxy-1,4-naphthoquinone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-18334 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2644241 | Reaxys |