EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O6 |
| Net Charge | 0 |
| Average Mass | 260.286 |
| Monoisotopic Mass | 260.12599 |
| SMILES | CCC(=O)OCC(COC(=O)CC)OC(=O)CC |
| InChI | InChI=1S/C12H20O6/c1-4-10(13)16-7-9(18-12(15)6-3)8-17-11(14)5-2/h9H,4-8H2,1-3H3 |
| InChIKey | YZWRNSARCRTXDS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tripropionin (CHEBI:88153) has role flavouring agent (CHEBI:35617) |
| tripropionin (CHEBI:88153) is a propanoate ester (CHEBI:36243) |
| tripropionin (CHEBI:88153) is a triglyceride (CHEBI:17855) |
| IUPAC Name |
|---|
| propane-1,2,3-triyl tripropanoate |
| Synonyms | Source |
|---|---|
| 1,2,3-propanetriol tripropanoate | ChemIDplus |
| 2,3-di(propanoyloxy)propyl propanoate | ChEBI |
| glycerine tripropionate | NIST Chemistry WebBook |
| glycerol tripropionate | NIST Chemistry WebBook |
| glyceryl tripropanoate | ChemIDplus |
| glyceryl tripropionate | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| 1,2,3-tripropanoylglycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0032857 | HMDB |
| Citations |
|---|