EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO3 |
| Net Charge | 0 |
| Average Mass | 129.115 |
| Monoisotopic Mass | 129.04259 |
| SMILES | O=C(O)C1=NC[C@@H](O)C1 |
| InChI | InChI=1S/C5H7NO3/c7-3-1-4(5(8)9)6-2-3/h3,7H,1-2H2,(H,8,9)/t3-/m0/s1 |
| InChIKey | AOMLMYXPXUTBQH-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-4-hydroxy-1-pyrroline-2-carboxylic acid (CHEBI:88149) is a 4-hydroxy-1-pyrroline-2-carboxylic acid (CHEBI:16352) |
| (S)-4-hydroxy-1-pyrroline-2-carboxylic acid (CHEBI:88149) is conjugate acid of (S)-4-hydroxy-1-pyrroline-2-carboxylate (CHEBI:87834) |
| Incoming Relation(s) |
| (S)-4-hydroxy-1-pyrroline-2-carboxylate (CHEBI:87834) is conjugate base of (S)-4-hydroxy-1-pyrroline-2-carboxylic acid (CHEBI:88149) |
| IUPAC Name |
|---|
| (3S)-3-hydroxy-3,4-dihydro-2H-pyrrole-5-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:471743 | Reaxys |