EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H13O8P |
| Net Charge | 0 |
| Average Mass | 232.125 |
| Monoisotopic Mass | 232.03480 |
| SMILES | O=P(O)(O)OC[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C5H13O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h3-9H,1-2H2,(H2,10,11,12)/t3-,4+,5-/m1/s1 |
| InChIKey | VJDOAZKNBQCAGE-MROZADKFSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-ribitol 1-phosphate (CHEBI:88133) has functional parent ribitol (CHEBI:15963) |
| D-ribitol 1-phosphate (CHEBI:88133) is a alditol 1-phosphate (CHEBI:22292) |
| D-ribitol 1-phosphate (CHEBI:88133) is a ribitol phosphate (CHEBI:26554) |
| D-ribitol 1-phosphate (CHEBI:88133) is conjugate acid of D-ribitol 1-phosphate(2−) (CHEBI:87817) |
| Incoming Relation(s) |
| D-ribitol 1-phosphate(2−) (CHEBI:87817) is conjugate base of D-ribitol 1-phosphate (CHEBI:88133) |
| IUPAC Name |
|---|
| D-ribitol 1-dihydrogen phosphate |
| Synonym | Source |
|---|---|
| 1-O-phosphono-D-ribitol | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23460727 | Reaxys |