EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26N2O |
| Net Charge | 0 |
| Average Mass | 250.386 |
| Monoisotopic Mass | 250.20451 |
| SMILES | [H][C@@]12[C@@H]3C[C@H](CN1CCC[C@@H]2O)[C@]1([H])CCCCN1C3 |
| InChI | InChI=1S/C15H26N2O/c18-14-5-3-7-17-9-11-8-12(15(14)17)10-16-6-2-1-4-13(11)16/h11-15,18H,1-10H2/t11?,12?,13-,14-,15-/m0/s1 |
| InChIKey | JMXNBIDTNISOTA-HGSUQPQSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Retamine (CHEBI:8813) is a quinolizidine alkaloid (CHEBI:26515) |
| Synonym | Source |
|---|---|
| Retamine | KEGG COMPOUND |