EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O3 |
| Net Charge | 0 |
| Average Mass | 370.533 |
| Monoisotopic Mass | 370.25079 |
| SMILES | [H][C@@]12C=CC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCC(=O)O |
| InChI | InChI=1S/C24H34O3/c1-15(4-9-22(26)27)19-7-8-20-18-6-5-16-14-17(25)10-12-23(16,2)21(18)11-13-24(19,20)3/h5-6,14-15,18-21H,4,7-13H2,1-3H3,(H,26,27)/t15-,18+,19-,20+,21+,23+,24-/m1/s1 |
| InChIKey | CREVIXFSUWYGRJ-IHMUCKAYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (8808760) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxochola-4,6-dien-24-oic acid (CHEBI:88112) has functional parent chola-4,6-dien-24-oic acid (CHEBI:49277) |
| 3-oxochola-4,6-dien-24-oic acid (CHEBI:88112) has role human metabolite (CHEBI:77746) |
| 3-oxochola-4,6-dien-24-oic acid (CHEBI:88112) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| 3-oxochola-4,6-dien-24-oic acid (CHEBI:88112) is a bile acid (CHEBI:3098) |
| 3-oxochola-4,6-dien-24-oic acid (CHEBI:88112) is conjugate acid of 3-oxochola-4,6-dien-24-oate (CHEBI:87748) |
| Incoming Relation(s) |
| 3-oxochola-4,6-dien-24-oate (CHEBI:87748) is conjugate base of 3-oxochola-4,6-dien-24-oic acid (CHEBI:88112) |
| IUPAC Name |
|---|
| 3-oxochola-4,6-dien-24-oic acid |
| Synonym | Source |
|---|---|
| 3-Oxo-4,6-choladienoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000476 | HMDB |
| LMST04010235 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4269971 | Reaxys |
| CAS:88179-71-9 | HMDB |
| Citations |
|---|